ethyl (2Z)-2-[(8xi,9xi,14xi,20Z)-16-ethyl-3-hydroxypregn-5-en-20-ylidene]hydrazine-1-carboxylate
Chemical Structure Depiction of
ethyl (2Z)-2-[(8xi,9xi,14xi,20Z)-16-ethyl-3-hydroxypregn-5-en-20-ylidene]hydrazine-1-carboxylate
ethyl (2Z)-2-[(8xi,9xi,14xi,20Z)-16-ethyl-3-hydroxypregn-5-en-20-ylidene]hydrazine-1-carboxylate
Compound characteristics
| Compound ID: | 8009-4225 |
| Compound Name: | ethyl (2Z)-2-[(8xi,9xi,14xi,20Z)-16-ethyl-3-hydroxypregn-5-en-20-ylidene]hydrazine-1-carboxylate |
| Molecular Weight: | 430.63 |
| Molecular Formula: | C26 H42 N2 O3 |
| Smiles: | CC[C@@H]1CC2C3CC=C4C[C@H](CC[C@]4(C)C3CC[C@]2(C)[C@H]1C(\C)=N/NC(=O)OCC)O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 5.8017 |
| logD: | 5.8008 |
| logSw: | -5.6526 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.237 |
| InChI Key: | KYGNNLDSEWCYTO-AZWSYFEGSA-N |