2-{1-[(3,4-dichlorophenyl)methyl]-1H-benzimidazol-2-yl}-1-(2-fluorophenyl)ethenyl 2-fluorobenzoate
Chemical Structure Depiction of
2-{1-[(3,4-dichlorophenyl)methyl]-1H-benzimidazol-2-yl}-1-(2-fluorophenyl)ethenyl 2-fluorobenzoate
2-{1-[(3,4-dichlorophenyl)methyl]-1H-benzimidazol-2-yl}-1-(2-fluorophenyl)ethenyl 2-fluorobenzoate
Compound characteristics
| Compound ID: | 8009-4641 |
| Compound Name: | 2-{1-[(3,4-dichlorophenyl)methyl]-1H-benzimidazol-2-yl}-1-(2-fluorophenyl)ethenyl 2-fluorobenzoate |
| Molecular Weight: | 535.38 |
| Molecular Formula: | C29 H18 Cl2 F2 N2 O2 |
| Smiles: | C(c1ccc(c(c1)[Cl])[Cl])n1c2ccccc2nc1/C=C(/c1ccccc1F)OC(c1ccccc1F)=O |
| Stereo: | ACHIRAL |
| logP: | 8.1962 |
| logD: | 8.1962 |
| logSw: | -6.7837 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 30.5598 |
| InChI Key: | DNPMLPKOPHWRHR-UHFFFAOYSA-N |