2-(4-chlorophenyl)-1,2,4-triazaspiro[4.5]decane-3-thione
					Chemical Structure Depiction of
2-(4-chlorophenyl)-1,2,4-triazaspiro[4.5]decane-3-thione
			2-(4-chlorophenyl)-1,2,4-triazaspiro[4.5]decane-3-thione
Compound characteristics
| Compound ID: | 8009-5179 | 
| Compound Name: | 2-(4-chlorophenyl)-1,2,4-triazaspiro[4.5]decane-3-thione | 
| Molecular Weight: | 281.8 | 
| Molecular Formula: | C13 H16 Cl N3 S | 
| Smiles: | C1CCC2(CC1)NC(N(c1ccc(cc1)[Cl])N2)=S | 
| Stereo: | ACHIRAL | 
| logP: | 3.6697 | 
| logD: | 3.6697 | 
| logSw: | -4.1972 | 
| Hydrogen bond acceptors count: | 3 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 27.8928 | 
| InChI Key: | QGBTWNUTZLSHKQ-UHFFFAOYSA-N | 
 
				 
				