8-bromo-5-methyl-3-(methylsulfanyl)-5H-[1,2,4]triazino[5,6-b]indole
Chemical Structure Depiction of
8-bromo-5-methyl-3-(methylsulfanyl)-5H-[1,2,4]triazino[5,6-b]indole
8-bromo-5-methyl-3-(methylsulfanyl)-5H-[1,2,4]triazino[5,6-b]indole
Compound characteristics
| Compound ID: | 8009-5268 |
| Compound Name: | 8-bromo-5-methyl-3-(methylsulfanyl)-5H-[1,2,4]triazino[5,6-b]indole |
| Molecular Weight: | 309.18 |
| Molecular Formula: | C11 H9 Br N4 S |
| Smiles: | Cn1c2ccc(cc2c2c1nc(nn2)SC)[Br] |
| Stereo: | ACHIRAL |
| logP: | 2.9552 |
| logD: | 2.9552 |
| logSw: | -2.9956 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 34.06 |
| InChI Key: | VUQCRWKYYGLLJJ-UHFFFAOYSA-N |