N'-benzoyl-6-bromo-2-oxo-2H-1-benzopyran-3-carbohydrazide
Chemical Structure Depiction of
N'-benzoyl-6-bromo-2-oxo-2H-1-benzopyran-3-carbohydrazide
N'-benzoyl-6-bromo-2-oxo-2H-1-benzopyran-3-carbohydrazide
Compound characteristics
| Compound ID: | 8009-5374 |
| Compound Name: | N'-benzoyl-6-bromo-2-oxo-2H-1-benzopyran-3-carbohydrazide |
| Molecular Weight: | 387.19 |
| Molecular Formula: | C17 H11 Br N2 O4 |
| Smiles: | C1=C(C(NNC(c2ccccc2)=O)=O)C(=O)Oc2ccc(cc12)[Br] |
| Stereo: | ACHIRAL |
| logP: | 2.5492 |
| logD: | 2.4823 |
| logSw: | -3.021 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.356 |
| InChI Key: | XKXCFILCUMVRRO-UHFFFAOYSA-N |