2-(4-methyl-1-oxophthalazin-2(1H)-yl)ethyl acetate
Chemical Structure Depiction of
2-(4-methyl-1-oxophthalazin-2(1H)-yl)ethyl acetate
2-(4-methyl-1-oxophthalazin-2(1H)-yl)ethyl acetate
Compound characteristics
| Compound ID: | 8009-5494 |
| Compound Name: | 2-(4-methyl-1-oxophthalazin-2(1H)-yl)ethyl acetate |
| Molecular Weight: | 246.26 |
| Molecular Formula: | C13 H14 N2 O3 |
| Smiles: | CC1c2ccccc2C(N(CCOC(C)=O)N=1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.262 |
| logD: | 1.262 |
| logSw: | -1.987 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 48.039 |
| InChI Key: | FYXQRWJKYUIKAI-UHFFFAOYSA-N |