3-(2-phenylethenyl)-5-(trifluoromethyl)-1,2-oxazole
Chemical Structure Depiction of
3-(2-phenylethenyl)-5-(trifluoromethyl)-1,2-oxazole
3-(2-phenylethenyl)-5-(trifluoromethyl)-1,2-oxazole
Compound characteristics
| Compound ID: | 8009-5663 |
| Compound Name: | 3-(2-phenylethenyl)-5-(trifluoromethyl)-1,2-oxazole |
| Molecular Weight: | 239.19 |
| Molecular Formula: | C12 H8 F3 N O |
| Smiles: | C(=C/c1cc(C(F)(F)F)on1)\c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 3.9728 |
| logD: | 3.9728 |
| logSw: | -4.3212 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 22.2689 |
| InChI Key: | QFPSOZUQQRBMBJ-UHFFFAOYSA-N |