1-(piperidin-1-yl)-2-(3-{[(4H-1,2,4-triazol-4-yl)amino]methyl}phenoxy)ethan-1-one
Chemical Structure Depiction of
1-(piperidin-1-yl)-2-(3-{[(4H-1,2,4-triazol-4-yl)amino]methyl}phenoxy)ethan-1-one
1-(piperidin-1-yl)-2-(3-{[(4H-1,2,4-triazol-4-yl)amino]methyl}phenoxy)ethan-1-one
Compound characteristics
| Compound ID: | 8009-6237 |
| Compound Name: | 1-(piperidin-1-yl)-2-(3-{[(4H-1,2,4-triazol-4-yl)amino]methyl}phenoxy)ethan-1-one |
| Molecular Weight: | 315.37 |
| Molecular Formula: | C16 H21 N5 O2 |
| Smiles: | C1CCN(CC1)C(COc1cccc(CNn2cnnc2)c1)=O |
| Stereo: | ACHIRAL |
| logP: | 0.3391 |
| logD: | 0.3391 |
| logSw: | -1.7132 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.937 |
| InChI Key: | HYDIOTCFKLIWKX-UHFFFAOYSA-N |