7-tert-butyl-3-phenyl-2-({[3-(trifluoromethyl)phenyl]methyl}sulfanyl)-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4(3H)-one
Chemical Structure Depiction of
7-tert-butyl-3-phenyl-2-({[3-(trifluoromethyl)phenyl]methyl}sulfanyl)-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4(3H)-one
7-tert-butyl-3-phenyl-2-({[3-(trifluoromethyl)phenyl]methyl}sulfanyl)-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4(3H)-one
Compound characteristics
| Compound ID: | 8009-6523 |
| Compound Name: | 7-tert-butyl-3-phenyl-2-({[3-(trifluoromethyl)phenyl]methyl}sulfanyl)-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4(3H)-one |
| Molecular Weight: | 528.66 |
| Molecular Formula: | C28 H27 F3 N2 O S2 |
| Smiles: | CC(C)(C)C1CCc2c3C(N(C(=Nc3sc2C1)SCc1cccc(c1)C(F)(F)F)c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 7.8169 |
| logD: | 7.8169 |
| logSw: | -5.8191 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 24.9824 |
| InChI Key: | WLSVYZPPIRAJLC-GOSISDBHSA-N |