ammonium--2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-nitrobenzoate (1/1)
Chemical Structure Depiction of
ammonium--2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-nitrobenzoate (1/1)
ammonium--2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-nitrobenzoate (1/1)
Compound characteristics
| Compound ID: | 8009-6542 |
| Compound Name: | ammonium--2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-nitrobenzoate (1/1) |
| Molecular Weight: | 374.39 |
| Molecular Formula: | C18 H18 N3 O5 |
| Salt: | NH4+ |
| Smiles: | COc1ccccc1N1CCN(CC1)c1ccc(cc1C([O-])=O)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 3.3248 |
| logD: | 3.3248 |
| logSw: | -3.7215 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 75.769 |
| InChI Key: | JFFYHMXFECZUKA-UHFFFAOYSA-M |