3-anilino-4-benzoyl-5-(4-bromophenyl)-1-phenyl-1,5-dihydro-2H-pyrrol-2-one
					Chemical Structure Depiction of
3-anilino-4-benzoyl-5-(4-bromophenyl)-1-phenyl-1,5-dihydro-2H-pyrrol-2-one
			3-anilino-4-benzoyl-5-(4-bromophenyl)-1-phenyl-1,5-dihydro-2H-pyrrol-2-one
Compound characteristics
| Compound ID: | 8009-7911 | 
| Compound Name: | 3-anilino-4-benzoyl-5-(4-bromophenyl)-1-phenyl-1,5-dihydro-2H-pyrrol-2-one | 
| Molecular Weight: | 509.4 | 
| Molecular Formula: | C29 H21 Br N2 O2 | 
| Smiles: | c1ccc(cc1)C(C1C(c2ccc(cc2)[Br])N(C(C=1Nc1ccccc1)=O)c1ccccc1)=O | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 6.4609 | 
| logD: | 6.4609 | 
| logSw: | -6.1478 | 
| Hydrogen bond acceptors count: | 4 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 38.256 | 
| InChI Key: | WZMBBLZMNFNRES-HHHXNRCGSA-N | 
 
				 
				