2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-cyclohexylprop-2-enenitrile
Chemical Structure Depiction of
2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-cyclohexylprop-2-enenitrile
2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-cyclohexylprop-2-enenitrile
Compound characteristics
| Compound ID: | 8009-7919 |
| Compound Name: | 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-cyclohexylprop-2-enenitrile |
| Molecular Weight: | 328.86 |
| Molecular Formula: | C18 H17 Cl N2 S |
| Smiles: | C1CCC(CC1)\C=C(/C#N)c1nc(cs1)c1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 6.238 |
| logD: | 6.238 |
| logSw: | -6.6022 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 26.9492 |
| InChI Key: | IUBTZWGYPQPPEG-UHFFFAOYSA-N |