N~1~-(2-methoxyethyl)-N~2~-[4-(pentyloxy)phenyl]ethanediamide
Chemical Structure Depiction of
N~1~-(2-methoxyethyl)-N~2~-[4-(pentyloxy)phenyl]ethanediamide
N~1~-(2-methoxyethyl)-N~2~-[4-(pentyloxy)phenyl]ethanediamide
Compound characteristics
| Compound ID: | 8009-8312 |
| Compound Name: | N~1~-(2-methoxyethyl)-N~2~-[4-(pentyloxy)phenyl]ethanediamide |
| Molecular Weight: | 308.38 |
| Molecular Formula: | C16 H24 N2 O4 |
| Smiles: | CCCCCOc1ccc(cc1)NC(C(NCCOC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.66 |
| logD: | 2.4808 |
| logSw: | -3.1168 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.888 |
| InChI Key: | BHSUTNIPZJAKTB-UHFFFAOYSA-N |