1-(2,6-dimethylmorpholin-4-yl)-2-(4-nitro-1H-pyrazol-1-yl)ethan-1-one
Chemical Structure Depiction of
1-(2,6-dimethylmorpholin-4-yl)-2-(4-nitro-1H-pyrazol-1-yl)ethan-1-one
1-(2,6-dimethylmorpholin-4-yl)-2-(4-nitro-1H-pyrazol-1-yl)ethan-1-one
Compound characteristics
| Compound ID: | 8009-8455 |
| Compound Name: | 1-(2,6-dimethylmorpholin-4-yl)-2-(4-nitro-1H-pyrazol-1-yl)ethan-1-one |
| Molecular Weight: | 268.27 |
| Molecular Formula: | C11 H16 N4 O4 |
| Smiles: | CC1CN(CC(C)O1)C(Cn1cc(cn1)[N+]([O-])=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | -0.2695 |
| logD: | -0.2695 |
| logSw: | -0.4937 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 71.45 |
| InChI Key: | YYOLBXMNZRDYCK-UHFFFAOYSA-N |