4-(4,8-dimethylnona-3,7-dien-1-yl)-4-methyl-5-methylidene-1,3-dioxolan-2-one
Chemical Structure Depiction of
4-(4,8-dimethylnona-3,7-dien-1-yl)-4-methyl-5-methylidene-1,3-dioxolan-2-one
4-(4,8-dimethylnona-3,7-dien-1-yl)-4-methyl-5-methylidene-1,3-dioxolan-2-one
Compound characteristics
| Compound ID: | 8009-8702 |
| Compound Name: | 4-(4,8-dimethylnona-3,7-dien-1-yl)-4-methyl-5-methylidene-1,3-dioxolan-2-one |
| Molecular Weight: | 264.36 |
| Molecular Formula: | C16 H24 O3 |
| Smiles: | CC(C)=CCCC(\C)=C\CCC1(C)C(=C)OC(=O)O1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.0104 |
| logD: | 5.0104 |
| logSw: | -4.4814 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 30.1663 |
| InChI Key: | PNAFHLHESBUDJC-INIZCTEOSA-N |