N'-(6-chloro-3-cyano-4-methylpyridin-2-yl)-N'-ethylbutanehydrazide
Chemical Structure Depiction of
N'-(6-chloro-3-cyano-4-methylpyridin-2-yl)-N'-ethylbutanehydrazide
N'-(6-chloro-3-cyano-4-methylpyridin-2-yl)-N'-ethylbutanehydrazide
Compound characteristics
| Compound ID: | 8009-8756 |
| Compound Name: | N'-(6-chloro-3-cyano-4-methylpyridin-2-yl)-N'-ethylbutanehydrazide |
| Molecular Weight: | 280.75 |
| Molecular Formula: | C13 H17 Cl N4 O |
| Smiles: | CCCC(NN(CC)c1c(C#N)c(C)cc(n1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 2.72 |
| logD: | 2.4176 |
| logSw: | -3.7132 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.996 |
| InChI Key: | QDIQPLQUDQSHNX-UHFFFAOYSA-N |