2-(4-chlorophenyl)-4,4,6,8-tetramethyl-4,5-dihydro[1,2]thiazolo[5,4-c]quinoline-1(2H)-thione
					Chemical Structure Depiction of
2-(4-chlorophenyl)-4,4,6,8-tetramethyl-4,5-dihydro[1,2]thiazolo[5,4-c]quinoline-1(2H)-thione
			2-(4-chlorophenyl)-4,4,6,8-tetramethyl-4,5-dihydro[1,2]thiazolo[5,4-c]quinoline-1(2H)-thione
Compound characteristics
| Compound ID: | 8009-8928 | 
| Compound Name: | 2-(4-chlorophenyl)-4,4,6,8-tetramethyl-4,5-dihydro[1,2]thiazolo[5,4-c]quinoline-1(2H)-thione | 
| Molecular Weight: | 386.96 | 
| Molecular Formula: | C20 H19 Cl N2 S2 | 
| Smiles: | Cc1cc(C)c2c(c1)C1=C(C(C)(C)N2)SN(C1=S)c1ccc(cc1)[Cl] | 
| Stereo: | ACHIRAL | 
| logP: | 5.95 | 
| logD: | 5.9207 | 
| logSw: | -6.3575 | 
| Hydrogen bond acceptors count: | 3 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 12.4538 | 
| InChI Key: | VTRDAOHSGXNRLZ-UHFFFAOYSA-N | 
 
				 
				