ethyl 2-amino-4-(4-fluorophenyl)-7,7-dimethyl-5-oxo-1-(4-sulfamoylphenyl)-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
Chemical Structure Depiction of
ethyl 2-amino-4-(4-fluorophenyl)-7,7-dimethyl-5-oxo-1-(4-sulfamoylphenyl)-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
ethyl 2-amino-4-(4-fluorophenyl)-7,7-dimethyl-5-oxo-1-(4-sulfamoylphenyl)-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
Compound characteristics
| Compound ID: | 8009-9065 |
| Compound Name: | ethyl 2-amino-4-(4-fluorophenyl)-7,7-dimethyl-5-oxo-1-(4-sulfamoylphenyl)-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate |
| Molecular Weight: | 513.59 |
| Molecular Formula: | C26 H28 F N3 O5 S |
| Smiles: | CCOC(C1C(C2=C(CC(C)(C)CC2=O)N(C=1N)c1ccc(cc1)S(N)(=O)=O)c1ccc(cc1)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.6112 |
| logD: | 2.6101 |
| logSw: | -3.0034 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 106.677 |
| InChI Key: | HGHPMUVAMDZRJI-NRFANRHFSA-N |