3-phenyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine-2,4(1H,3H)-dione
Chemical Structure Depiction of
3-phenyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine-2,4(1H,3H)-dione
3-phenyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine-2,4(1H,3H)-dione
Compound characteristics
| Compound ID: | 8009-9089 |
| Compound Name: | 3-phenyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine-2,4(1H,3H)-dione |
| Molecular Weight: | 298.36 |
| Molecular Formula: | C16 H14 N2 O2 S |
| Smiles: | C1CCc2c(C1)c1C(N(C(Nc1s2)=O)c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1487 |
| logD: | 2.6228 |
| logSw: | -3.4695 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.692 |
| InChI Key: | AWIDMARRIHALJP-UHFFFAOYSA-N |