(3,5-dibromophenyl)(pyrrolidin-1-yl)methanone
Chemical Structure Depiction of
(3,5-dibromophenyl)(pyrrolidin-1-yl)methanone
(3,5-dibromophenyl)(pyrrolidin-1-yl)methanone
Compound characteristics
| Compound ID: | 8009-9212 |
| Compound Name: | (3,5-dibromophenyl)(pyrrolidin-1-yl)methanone |
| Molecular Weight: | 333.02 |
| Molecular Formula: | C11 H11 Br2 N O |
| Smiles: | C1CCN(C1)C(c1cc(cc(c1)[Br])[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 3.7659 |
| logD: | 3.7659 |
| logSw: | -3.8709 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 17.2527 |
| InChI Key: | UISWSPSAAVNZTL-UHFFFAOYSA-N |