3-(2,4-dinitrophenyl)-2H-1-benzopyran-2-one
Chemical Structure Depiction of
3-(2,4-dinitrophenyl)-2H-1-benzopyran-2-one
3-(2,4-dinitrophenyl)-2H-1-benzopyran-2-one
Compound characteristics
| Compound ID: | 8009-9684 |
| Compound Name: | 3-(2,4-dinitrophenyl)-2H-1-benzopyran-2-one |
| Molecular Weight: | 312.24 |
| Molecular Formula: | C15 H8 N2 O6 |
| Smiles: | C1=C(C(=O)Oc2ccccc12)c1ccc(cc1[N+]([O-])=O)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 3.0465 |
| logD: | 3.0465 |
| logSw: | -3.7169 |
| Hydrogen bond acceptors count: | 11 |
| Polar surface area: | 87.351 |
| InChI Key: | JYLPTNIAOYPVOY-UHFFFAOYSA-N |