5-(3,4-dimethylphenyl)-3-{[1-(2-fluorophenyl)-1H-pyrrol-2-yl]methylidene}furan-2(3H)-one
Chemical Structure Depiction of
5-(3,4-dimethylphenyl)-3-{[1-(2-fluorophenyl)-1H-pyrrol-2-yl]methylidene}furan-2(3H)-one
5-(3,4-dimethylphenyl)-3-{[1-(2-fluorophenyl)-1H-pyrrol-2-yl]methylidene}furan-2(3H)-one
Compound characteristics
| Compound ID: | 8010-0643 |
| Compound Name: | 5-(3,4-dimethylphenyl)-3-{[1-(2-fluorophenyl)-1H-pyrrol-2-yl]methylidene}furan-2(3H)-one |
| Molecular Weight: | 359.4 |
| Molecular Formula: | C23 H18 F N O2 |
| Smiles: | Cc1ccc(cc1C)C1=C/C(=C\c2cccn2c2ccccc2F)C(=O)O1 |
| Stereo: | ACHIRAL |
| logP: | 5.9271 |
| logD: | 5.9271 |
| logSw: | -5.5793 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 24.9684 |
| InChI Key: | DLXYUFSHOIZMBB-UHFFFAOYSA-N |