8-(dimethylamino)-1,3-dimethyl-7-(2-oxo-2-phenylethyl)-3,7-dihydro-1H-purine-2,6-dione
Chemical Structure Depiction of
8-(dimethylamino)-1,3-dimethyl-7-(2-oxo-2-phenylethyl)-3,7-dihydro-1H-purine-2,6-dione
8-(dimethylamino)-1,3-dimethyl-7-(2-oxo-2-phenylethyl)-3,7-dihydro-1H-purine-2,6-dione
Compound characteristics
| Compound ID: | 8010-0811 |
| Compound Name: | 8-(dimethylamino)-1,3-dimethyl-7-(2-oxo-2-phenylethyl)-3,7-dihydro-1H-purine-2,6-dione |
| Molecular Weight: | 341.37 |
| Molecular Formula: | C17 H19 N5 O3 |
| Smiles: | CN(C)c1nc2c(C(N(C)C(N2C)=O)=O)n1CC(c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9043 |
| logD: | 1.9043 |
| logSw: | -2.3079 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 58.297 |
| InChI Key: | AOBNOWRAGPJRLJ-UHFFFAOYSA-N |