4-(5-{[2-(3,4-dimethylanilino)-2-oxoethyl]sulfanyl}-1H-tetrazol-1-yl)benzamide
Chemical Structure Depiction of
4-(5-{[2-(3,4-dimethylanilino)-2-oxoethyl]sulfanyl}-1H-tetrazol-1-yl)benzamide
4-(5-{[2-(3,4-dimethylanilino)-2-oxoethyl]sulfanyl}-1H-tetrazol-1-yl)benzamide
Compound characteristics
| Compound ID: | 8010-1070 |
| Compound Name: | 4-(5-{[2-(3,4-dimethylanilino)-2-oxoethyl]sulfanyl}-1H-tetrazol-1-yl)benzamide |
| Molecular Weight: | 382.44 |
| Molecular Formula: | C18 H18 N6 O2 S |
| Smiles: | Cc1ccc(cc1C)NC(CSc1nnnn1c1ccc(cc1)C(N)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5285 |
| logD: | 2.5285 |
| logSw: | -2.8582 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 97.097 |
| InChI Key: | PAIDZRNXZSBGEK-UHFFFAOYSA-N |