ethyl 2-{[5-(3,4-dichlorophenyl)furan-2-yl]methylidene}-7-methyl-3-oxo-5-(thiophen-2-yl)-2,3-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate
Chemical Structure Depiction of
ethyl 2-{[5-(3,4-dichlorophenyl)furan-2-yl]methylidene}-7-methyl-3-oxo-5-(thiophen-2-yl)-2,3-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate
ethyl 2-{[5-(3,4-dichlorophenyl)furan-2-yl]methylidene}-7-methyl-3-oxo-5-(thiophen-2-yl)-2,3-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate
Compound characteristics
| Compound ID: | 8010-1813 |
| Compound Name: | ethyl 2-{[5-(3,4-dichlorophenyl)furan-2-yl]methylidene}-7-methyl-3-oxo-5-(thiophen-2-yl)-2,3-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| Molecular Weight: | 545.46 |
| Molecular Formula: | C25 H18 Cl2 N2 O4 S2 |
| Smiles: | CCOC(C1C(c2cccs2)N2C(=NC=1C)SC(=C\c1ccc(c3ccc(c(c3)[Cl])[Cl])o1)\C2=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.6085 |
| logD: | 6.6085 |
| logSw: | -6.3136 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 54.335 |
| InChI Key: | ZOQJULLERCHSTM-QFIPXVFZSA-N |