[5-hydroxy-5-(4-pentylphenyl)-3-(trifluoromethyl)-4,5-dihydro-1H-pyrazol-1-yl](2-nitrophenyl)methanone
Chemical Structure Depiction of
[5-hydroxy-5-(4-pentylphenyl)-3-(trifluoromethyl)-4,5-dihydro-1H-pyrazol-1-yl](2-nitrophenyl)methanone
[5-hydroxy-5-(4-pentylphenyl)-3-(trifluoromethyl)-4,5-dihydro-1H-pyrazol-1-yl](2-nitrophenyl)methanone
Compound characteristics
| Compound ID: | 8010-2123 |
| Compound Name: | [5-hydroxy-5-(4-pentylphenyl)-3-(trifluoromethyl)-4,5-dihydro-1H-pyrazol-1-yl](2-nitrophenyl)methanone |
| Molecular Weight: | 449.43 |
| Molecular Formula: | C22 H22 F3 N3 O4 |
| Smiles: | CCCCCc1ccc(cc1)C1(CC(C(F)(F)F)=NN1C(c1ccccc1[N+]([O-])=O)=O)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3923 |
| logD: | 5.3923 |
| logSw: | -5.1477 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 76.599 |
| InChI Key: | VPLZIRUIGAAFLL-NRFANRHFSA-N |