N-(3,4-dimethoxyphenyl)-2-(3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)acetamide
Chemical Structure Depiction of
N-(3,4-dimethoxyphenyl)-2-(3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)acetamide
N-(3,4-dimethoxyphenyl)-2-(3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)acetamide
Compound characteristics
| Compound ID: | 8010-2571 |
| Compound Name: | N-(3,4-dimethoxyphenyl)-2-(3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)acetamide |
| Molecular Weight: | 334.33 |
| Molecular Formula: | C15 H18 N4 O5 |
| Smiles: | Cc1c(c(C)n(CC(Nc2ccc(c(c2)OC)OC)=O)n1)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 1.2348 |
| logD: | 1.2347 |
| logSw: | -2.4292 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 85.71 |
| InChI Key: | GUOSQCZGYQTRIU-UHFFFAOYSA-N |