4-[(2H-1,3-benzodioxol-5-yl)methylidene]-1-(3,4-dichlorophenyl)pyrazolidine-3,5-dione
Chemical Structure Depiction of
4-[(2H-1,3-benzodioxol-5-yl)methylidene]-1-(3,4-dichlorophenyl)pyrazolidine-3,5-dione
4-[(2H-1,3-benzodioxol-5-yl)methylidene]-1-(3,4-dichlorophenyl)pyrazolidine-3,5-dione
Compound characteristics
| Compound ID: | 8010-2615 |
| Compound Name: | 4-[(2H-1,3-benzodioxol-5-yl)methylidene]-1-(3,4-dichlorophenyl)pyrazolidine-3,5-dione |
| Molecular Weight: | 377.18 |
| Molecular Formula: | C17 H10 Cl2 N2 O4 |
| Smiles: | C1Oc2ccc(\C=C3/C(NN(C3=O)c3ccc(c(c3)[Cl])[Cl])=O)cc2O1 |
| Stereo: | ACHIRAL |
| logP: | 3.7322 |
| logD: | 2.664 |
| logSw: | -4.2759 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.875 |
| InChI Key: | CEQPKVOXQXHKFE-UHFFFAOYSA-N |