2-(4-bromophenyl)-2-oxoethyl 6-iodo-2-phenylquinoline-4-carboxylate
Chemical Structure Depiction of
2-(4-bromophenyl)-2-oxoethyl 6-iodo-2-phenylquinoline-4-carboxylate
2-(4-bromophenyl)-2-oxoethyl 6-iodo-2-phenylquinoline-4-carboxylate
Compound characteristics
| Compound ID: | 8010-2686 |
| Compound Name: | 2-(4-bromophenyl)-2-oxoethyl 6-iodo-2-phenylquinoline-4-carboxylate |
| Molecular Weight: | 572.2 |
| Molecular Formula: | C24 H15 Br I N O3 |
| Smiles: | C(C(c1ccc(cc1)[Br])=O)OC(c1cc(c2ccccc2)nc2ccc(cc12)I)=O |
| Stereo: | ACHIRAL |
| logP: | 7.8562 |
| logD: | 7.8534 |
| logSw: | -6.4153 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 42.402 |
| InChI Key: | IIVJJMZOYBRPRH-UHFFFAOYSA-N |