3'-(3-bromo-4-methylphenyl)spiro[indole-3,2'-[1,3]thiazolidine]-2,4'(1H)-dione
Chemical Structure Depiction of
3'-(3-bromo-4-methylphenyl)spiro[indole-3,2'-[1,3]thiazolidine]-2,4'(1H)-dione
3'-(3-bromo-4-methylphenyl)spiro[indole-3,2'-[1,3]thiazolidine]-2,4'(1H)-dione
Compound characteristics
| Compound ID: | 8010-2808 |
| Compound Name: | 3'-(3-bromo-4-methylphenyl)spiro[indole-3,2'-[1,3]thiazolidine]-2,4'(1H)-dione |
| Molecular Weight: | 389.27 |
| Molecular Formula: | C17 H13 Br N2 O2 S |
| Smiles: | Cc1ccc(cc1[Br])N1C(CSC12C(Nc1ccccc12)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8995 |
| logD: | 3.8994 |
| logSw: | -3.9455 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.811 |
| InChI Key: | AOLHEIMJPMITGT-KRWDZBQOSA-N |