4-(3-bromo-4,5-dimethoxyphenyl)-3,4-dihydrobenzo[h]quinolin-2(1H)-one
Chemical Structure Depiction of
4-(3-bromo-4,5-dimethoxyphenyl)-3,4-dihydrobenzo[h]quinolin-2(1H)-one
4-(3-bromo-4,5-dimethoxyphenyl)-3,4-dihydrobenzo[h]quinolin-2(1H)-one
Compound characteristics
| Compound ID: | 8010-5594 |
| Compound Name: | 4-(3-bromo-4,5-dimethoxyphenyl)-3,4-dihydrobenzo[h]quinolin-2(1H)-one |
| Molecular Weight: | 412.28 |
| Molecular Formula: | C21 H18 Br N O3 |
| Smiles: | COc1cc(cc(c1OC)[Br])C1CC(Nc2c1ccc1ccccc12)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.407 |
| logD: | 4.407 |
| logSw: | -4.7551 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.611 |
| InChI Key: | WAWDHBJYONLCMT-INIZCTEOSA-N |