2-[(2-cyanophenyl)sulfanyl]-N-[2-(3,4-dimethylphenoxy)ethyl]benzamide
Chemical Structure Depiction of
2-[(2-cyanophenyl)sulfanyl]-N-[2-(3,4-dimethylphenoxy)ethyl]benzamide
2-[(2-cyanophenyl)sulfanyl]-N-[2-(3,4-dimethylphenoxy)ethyl]benzamide
Compound characteristics
| Compound ID: | 8010-5623 |
| Compound Name: | 2-[(2-cyanophenyl)sulfanyl]-N-[2-(3,4-dimethylphenoxy)ethyl]benzamide |
| Molecular Weight: | 402.51 |
| Molecular Formula: | C24 H22 N2 O2 S |
| Smiles: | Cc1ccc(cc1C)OCCNC(c1ccccc1Sc1ccccc1C#N)=O |
| Stereo: | ACHIRAL |
| logP: | 6.0174 |
| logD: | 6.0174 |
| logSw: | -5.4688 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.696 |
| InChI Key: | CZIONTZVPCQNMQ-UHFFFAOYSA-N |