ethyl 5-methoxy-2-methyl-1H-indole-3-carboxylate
Chemical Structure Depiction of
ethyl 5-methoxy-2-methyl-1H-indole-3-carboxylate
ethyl 5-methoxy-2-methyl-1H-indole-3-carboxylate
Compound characteristics
| Compound ID: | 8010-5773 |
| Compound Name: | ethyl 5-methoxy-2-methyl-1H-indole-3-carboxylate |
| Molecular Weight: | 233.26 |
| Molecular Formula: | C13 H15 N O3 |
| Smiles: | CCOC(c1c2cc(ccc2[nH]c1C)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 2.747 |
| logD: | 2.747 |
| logSw: | -3.0707 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.462 |
| InChI Key: | IRBNTIJXCHIBNA-UHFFFAOYSA-N |