N-(2-chloroethyl)-2-[(diphenylphosphoryl)methyl]aniline
Chemical Structure Depiction of
N-(2-chloroethyl)-2-[(diphenylphosphoryl)methyl]aniline
N-(2-chloroethyl)-2-[(diphenylphosphoryl)methyl]aniline
Compound characteristics
| Compound ID: | 8010-5855 |
| Compound Name: | N-(2-chloroethyl)-2-[(diphenylphosphoryl)methyl]aniline |
| Molecular Weight: | 369.83 |
| Molecular Formula: | C21 H21 Cl N O P |
| Smiles: | C(C[Cl])Nc1ccccc1CP(c1ccccc1)(c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2936 |
| logD: | 5.2936 |
| logSw: | -5.6105 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 21.4845 |
| InChI Key: | HIVPKGWSZOUPRG-UHFFFAOYSA-N |