2-[methoxy(phenyl)methyl]-5,9-dimethyl-3-phenyl-7H-furo[3,2-g][1]benzopyran-7-one
Chemical Structure Depiction of
2-[methoxy(phenyl)methyl]-5,9-dimethyl-3-phenyl-7H-furo[3,2-g][1]benzopyran-7-one
2-[methoxy(phenyl)methyl]-5,9-dimethyl-3-phenyl-7H-furo[3,2-g][1]benzopyran-7-one
Compound characteristics
| Compound ID: | 8010-5945 |
| Compound Name: | 2-[methoxy(phenyl)methyl]-5,9-dimethyl-3-phenyl-7H-furo[3,2-g][1]benzopyran-7-one |
| Molecular Weight: | 410.47 |
| Molecular Formula: | C27 H22 O4 |
| Smiles: | CC1=CC(=O)Oc2c1cc1c(c3ccccc3)c(C(c3ccccc3)OC)oc1c2C |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.0691 |
| logD: | 6.0691 |
| logSw: | -5.7905 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 35.846 |
| InChI Key: | RUBTWBGJNVEVOB-AREMUKBSSA-N |