2-{4-[4-nitro-2-(trifluoromethyl)phenyl]piperazin-1-yl}ethan-1-ol
Chemical Structure Depiction of
2-{4-[4-nitro-2-(trifluoromethyl)phenyl]piperazin-1-yl}ethan-1-ol
2-{4-[4-nitro-2-(trifluoromethyl)phenyl]piperazin-1-yl}ethan-1-ol
Compound characteristics
| Compound ID: | 8010-6941 |
| Compound Name: | 2-{4-[4-nitro-2-(trifluoromethyl)phenyl]piperazin-1-yl}ethan-1-ol |
| Molecular Weight: | 319.28 |
| Molecular Formula: | C13 H16 F3 N3 O3 |
| Smiles: | C1CN(CCN1CCO)c1ccc(cc1C(F)(F)F)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 2.2292 |
| logD: | 1.7059 |
| logSw: | -2.6472 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.217 |
| InChI Key: | OHMSXYDQVXWAHX-UHFFFAOYSA-N |