2-[(2-chloro-4-fluorophenyl)methyl]-5-(2-methylphenyl)-2H-tetrazole
Chemical Structure Depiction of
2-[(2-chloro-4-fluorophenyl)methyl]-5-(2-methylphenyl)-2H-tetrazole
2-[(2-chloro-4-fluorophenyl)methyl]-5-(2-methylphenyl)-2H-tetrazole
Compound characteristics
| Compound ID: | 8010-8897 |
| Compound Name: | 2-[(2-chloro-4-fluorophenyl)methyl]-5-(2-methylphenyl)-2H-tetrazole |
| Molecular Weight: | 302.74 |
| Molecular Formula: | C15 H12 Cl F N4 |
| Smiles: | Cc1ccccc1c1nnn(Cc2ccc(cc2[Cl])F)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.1771 |
| logD: | 4.1771 |
| logSw: | -4.4176 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 38.342 |
| InChI Key: | AASYFAORRVLNCI-UHFFFAOYSA-N |