2-amino-N-cyclohexylbenzamide
Chemical Structure Depiction of
2-amino-N-cyclohexylbenzamide
2-amino-N-cyclohexylbenzamide
Compound characteristics
| Compound ID: | 8010-9023 |
| Compound Name: | 2-amino-N-cyclohexylbenzamide |
| Molecular Weight: | 218.3 |
| Molecular Formula: | C13 H18 N2 O |
| Smiles: | C1CCC(CC1)NC(c1ccccc1N)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7783 |
| logD: | 2.7783 |
| logSw: | -3.316 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 44.473 |
| InChI Key: | AHWGBTCRPVCUBP-UHFFFAOYSA-N |