3-(3-chloro-4-methylphenyl)-2-ethyl-2-methyl-2,3-dihydroquinazolin-4(1H)-one
Chemical Structure Depiction of
3-(3-chloro-4-methylphenyl)-2-ethyl-2-methyl-2,3-dihydroquinazolin-4(1H)-one
3-(3-chloro-4-methylphenyl)-2-ethyl-2-methyl-2,3-dihydroquinazolin-4(1H)-one
Compound characteristics
| Compound ID: | 8010-9452 |
| Compound Name: | 3-(3-chloro-4-methylphenyl)-2-ethyl-2-methyl-2,3-dihydroquinazolin-4(1H)-one |
| Molecular Weight: | 314.81 |
| Molecular Formula: | C18 H19 Cl N2 O |
| Smiles: | CCC1(C)Nc2ccccc2C(N1c1ccc(C)c(c1)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.9875 |
| logD: | 4.9875 |
| logSw: | -4.9442 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 26.6852 |
| InChI Key: | LPHLLKYLRFMLEH-SFHVURJKSA-N |