5-cyano-2-methyl-6-({2-[(naphthalen-2-yl)amino]-2-oxoethyl}sulfanyl)-N-phenyl-4-(thiophen-2-yl)-1,4-dihydropyridine-3-carboxamide
Chemical Structure Depiction of
5-cyano-2-methyl-6-({2-[(naphthalen-2-yl)amino]-2-oxoethyl}sulfanyl)-N-phenyl-4-(thiophen-2-yl)-1,4-dihydropyridine-3-carboxamide
5-cyano-2-methyl-6-({2-[(naphthalen-2-yl)amino]-2-oxoethyl}sulfanyl)-N-phenyl-4-(thiophen-2-yl)-1,4-dihydropyridine-3-carboxamide
Compound characteristics
| Compound ID: | 8011-2414 |
| Compound Name: | 5-cyano-2-methyl-6-({2-[(naphthalen-2-yl)amino]-2-oxoethyl}sulfanyl)-N-phenyl-4-(thiophen-2-yl)-1,4-dihydropyridine-3-carboxamide |
| Molecular Weight: | 536.67 |
| Molecular Formula: | C30 H24 N4 O2 S2 |
| Smiles: | CC1=C(C(C(C#N)=C(N1)SCC(Nc1ccc2ccccc2c1)=O)c1cccs1)C(Nc1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.6446 |
| logD: | 4.8036 |
| logSw: | -6.3549 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 73.818 |
| InChI Key: | NKUSFZDDIRHQRE-NDEPHWFRSA-N |