ethyl [2-(3,4-dimethoxyphenyl)-1,3-dioxo-2,3-dihydro-1H-inden-2-yl]acetate
Chemical Structure Depiction of
ethyl [2-(3,4-dimethoxyphenyl)-1,3-dioxo-2,3-dihydro-1H-inden-2-yl]acetate
ethyl [2-(3,4-dimethoxyphenyl)-1,3-dioxo-2,3-dihydro-1H-inden-2-yl]acetate
Compound characteristics
| Compound ID: | 8011-2730 |
| Compound Name: | ethyl [2-(3,4-dimethoxyphenyl)-1,3-dioxo-2,3-dihydro-1H-inden-2-yl]acetate |
| Molecular Weight: | 368.38 |
| Molecular Formula: | C21 H20 O6 |
| Smiles: | CCOC(CC1(C(c2ccccc2C1=O)=O)c1ccc(c(c1)OC)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0902 |
| logD: | 3.0902 |
| logSw: | -3.3561 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 61.966 |
| InChI Key: | YSVHPRBZNNADQG-UHFFFAOYSA-N |