4-(2-phenylethyl)-5-(pyridin-4-yl)-4H-1,2,4-triazole-3-thiol
Chemical Structure Depiction of
4-(2-phenylethyl)-5-(pyridin-4-yl)-4H-1,2,4-triazole-3-thiol
4-(2-phenylethyl)-5-(pyridin-4-yl)-4H-1,2,4-triazole-3-thiol
Compound characteristics
| Compound ID: | 8011-4267 |
| Compound Name: | 4-(2-phenylethyl)-5-(pyridin-4-yl)-4H-1,2,4-triazole-3-thiol |
| Molecular Weight: | 282.36 |
| Molecular Formula: | C15 H14 N4 S |
| Smiles: | C(Cn1c(c2ccncc2)nnc1S)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 2.4228 |
| logD: | 2.0784 |
| logSw: | -2.0894 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.121 |
| InChI Key: | FTDIEIPUQNIGTN-UHFFFAOYSA-N |