5-tert-butyl-2-methylfuran-3-carboxamide
Chemical Structure Depiction of
5-tert-butyl-2-methylfuran-3-carboxamide
5-tert-butyl-2-methylfuran-3-carboxamide
Compound characteristics
| Compound ID: | 8011-4385 |
| Compound Name: | 5-tert-butyl-2-methylfuran-3-carboxamide |
| Molecular Weight: | 181.23 |
| Molecular Formula: | C10 H15 N O2 |
| Smiles: | Cc1c(cc(C(C)(C)C)o1)C(N)=O |
| Stereo: | ACHIRAL |
| logP: | 1.8248 |
| logD: | 1.8248 |
| logSw: | -1.9208 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 42.623 |
| InChI Key: | JERNMWLTDZPEAE-UHFFFAOYSA-N |