3-(5-phenylfuran-2-yl)propanoic acid
Chemical Structure Depiction of
3-(5-phenylfuran-2-yl)propanoic acid
3-(5-phenylfuran-2-yl)propanoic acid
Compound characteristics
| Compound ID: | 8011-4497 |
| Compound Name: | 3-(5-phenylfuran-2-yl)propanoic acid |
| Molecular Weight: | 216.23 |
| Molecular Formula: | C13 H12 O3 |
| Smiles: | C(Cc1ccc(c2ccccc2)o1)C(O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7127 |
| logD: | -0.1012 |
| logSw: | -2.8623 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 36.192 |
| InChI Key: | JKBUDDSGMWGQDN-UHFFFAOYSA-N |