1-{ethyl[(1H-indol-3-yl)acetyl]amino}-N-(3-methylphenyl)cyclohexane-1-carboxamide
Chemical Structure Depiction of
1-{ethyl[(1H-indol-3-yl)acetyl]amino}-N-(3-methylphenyl)cyclohexane-1-carboxamide
1-{ethyl[(1H-indol-3-yl)acetyl]amino}-N-(3-methylphenyl)cyclohexane-1-carboxamide
Compound characteristics
| Compound ID: | 8011-4789 |
| Compound Name: | 1-{ethyl[(1H-indol-3-yl)acetyl]amino}-N-(3-methylphenyl)cyclohexane-1-carboxamide |
| Molecular Weight: | 417.55 |
| Molecular Formula: | C26 H31 N3 O2 |
| Smiles: | CCN(C(Cc1c[nH]c2ccccc12)=O)C1(CCCCC1)C(Nc1cccc(C)c1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6325 |
| logD: | 5.6325 |
| logSw: | -5.4867 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 47.837 |
| InChI Key: | UOWPCVLHQOXEGY-UHFFFAOYSA-N |