methyl 5-[(5-{[2-ethoxy(oxo)acetamido]methyl}furan-2-yl)methylidene]-2-methyl-4-oxo-1-phenyl-4,5-dihydro-1H-pyrrole-3-carboxylate
Chemical Structure Depiction of
methyl 5-[(5-{[2-ethoxy(oxo)acetamido]methyl}furan-2-yl)methylidene]-2-methyl-4-oxo-1-phenyl-4,5-dihydro-1H-pyrrole-3-carboxylate
methyl 5-[(5-{[2-ethoxy(oxo)acetamido]methyl}furan-2-yl)methylidene]-2-methyl-4-oxo-1-phenyl-4,5-dihydro-1H-pyrrole-3-carboxylate
Compound characteristics
| Compound ID: | 8011-6096 |
| Compound Name: | methyl 5-[(5-{[2-ethoxy(oxo)acetamido]methyl}furan-2-yl)methylidene]-2-methyl-4-oxo-1-phenyl-4,5-dihydro-1H-pyrrole-3-carboxylate |
| Molecular Weight: | 438.44 |
| Molecular Formula: | C23 H22 N2 O7 |
| Smiles: | CCOC(C(NCc1ccc(\C=C2/C(C(=C(C)N2c2ccccc2)C(=O)OC)=O)o1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0555 |
| logD: | 3.0486 |
| logSw: | -3.2723 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 87.862 |
| InChI Key: | KIGQCMMNTYEGTE-UHFFFAOYSA-N |