N,N'-[3-(4-methylphenyl)-1,2-oxazole-4,5-diylidene]dihydroxylamine
Chemical Structure Depiction of
N,N'-[3-(4-methylphenyl)-1,2-oxazole-4,5-diylidene]dihydroxylamine
N,N'-[3-(4-methylphenyl)-1,2-oxazole-4,5-diylidene]dihydroxylamine
Compound characteristics
| Compound ID: | 8011-6182 |
| Compound Name: | N,N'-[3-(4-methylphenyl)-1,2-oxazole-4,5-diylidene]dihydroxylamine |
| Molecular Weight: | 219.2 |
| Molecular Formula: | C10 H9 N3 O3 |
| Smiles: | Cc1ccc(cc1)C1\C(/C(=N/O)ON=1)=N/O |
| Stereo: | ACHIRAL |
| logP: | 0.7319 |
| logD: | 0.6448 |
| logSw: | -1.1871 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 80.955 |
| InChI Key: | BJPYKGWBGQNDLW-UHFFFAOYSA-N |