N-{4-[chloro(difluoro)methoxy]phenyl}-4,6-bis(morpholin-4-yl)-1,3,5-triazin-2-amine
Chemical Structure Depiction of
N-{4-[chloro(difluoro)methoxy]phenyl}-4,6-bis(morpholin-4-yl)-1,3,5-triazin-2-amine
N-{4-[chloro(difluoro)methoxy]phenyl}-4,6-bis(morpholin-4-yl)-1,3,5-triazin-2-amine
Compound characteristics
| Compound ID: | 8011-6487 |
| Compound Name: | N-{4-[chloro(difluoro)methoxy]phenyl}-4,6-bis(morpholin-4-yl)-1,3,5-triazin-2-amine |
| Molecular Weight: | 442.85 |
| Molecular Formula: | C18 H21 Cl F2 N6 O3 |
| Smiles: | C1COCCN1c1nc(Nc2ccc(cc2)OC(F)(F)[Cl])nc(n1)N1CCOCC1 |
| Stereo: | ACHIRAL |
| logP: | 4.6123 |
| logD: | 4.6109 |
| logSw: | -4.8324 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.225 |
| InChI Key: | UNDZBHCOOBFMTC-UHFFFAOYSA-N |