dimethyl 2~5~-oxo-2~3~,2~4~,2~5~,2~6~-tetrahydro[1~1~,2~1~:2~3~,3~1~-terphenyl]-2~2~,2~2~(2~1~H)-dicarboxylate
Chemical Structure Depiction of
dimethyl 2~5~-oxo-2~3~,2~4~,2~5~,2~6~-tetrahydro[1~1~,2~1~:2~3~,3~1~-terphenyl]-2~2~,2~2~(2~1~H)-dicarboxylate
dimethyl 2~5~-oxo-2~3~,2~4~,2~5~,2~6~-tetrahydro[1~1~,2~1~:2~3~,3~1~-terphenyl]-2~2~,2~2~(2~1~H)-dicarboxylate
Compound characteristics
| Compound ID: | 8011-6614 |
| Compound Name: | dimethyl 2~5~-oxo-2~3~,2~4~,2~5~,2~6~-tetrahydro[1~1~,2~1~:2~3~,3~1~-terphenyl]-2~2~,2~2~(2~1~H)-dicarboxylate |
| Molecular Weight: | 366.41 |
| Molecular Formula: | C22 H22 O5 |
| Smiles: | COC(C1(C(CC(CC1c1ccccc1)=O)c1ccccc1)C(=O)OC)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.7575 |
| logD: | 3.7575 |
| logSw: | -4.0554 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 55.584 |
| InChI Key: | FTUPPKXMEXHVCD-UHFFFAOYSA-N |