N~1~-(2-aminoethyl)-N~3~-cyclopropyl-4-nitrobenzene-1,3-diamine
Chemical Structure Depiction of
N~1~-(2-aminoethyl)-N~3~-cyclopropyl-4-nitrobenzene-1,3-diamine
N~1~-(2-aminoethyl)-N~3~-cyclopropyl-4-nitrobenzene-1,3-diamine
Compound characteristics
| Compound ID: | 8011-8369 |
| Compound Name: | N~1~-(2-aminoethyl)-N~3~-cyclopropyl-4-nitrobenzene-1,3-diamine |
| Molecular Weight: | 236.27 |
| Molecular Formula: | C11 H16 N4 O2 |
| Smiles: | C1CC1Nc1cc(ccc1[N+]([O-])=O)NCCN |
| Stereo: | ACHIRAL |
| logP: | 1.2945 |
| logD: | -0.4788 |
| logSw: | -2.1873 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 74.415 |
| InChI Key: | NUOXESICGIOAOT-UHFFFAOYSA-N |